ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
7-Ethoxy-4-methylcoumarin |
|
Ονομασία του προϊόντος | 7-Ethoxy-4-methylcoumarin |
Αγγλικό όνομα | 7-Ethoxy-4-methylcoumarin;7-Ethoxy-4-methyl-2H-chromen-2-one;Ethyl 4-methylumbelliferyl ether |
MF | C12H12O3 |
Μοριακό βάρος | 204.2219 |
InChI | InChI=1/C12H12O3/c1-3-14-9-4-5-10-8(2)6-12(13)15-11(10)7-9/h4-7H,3H2,1-2H3 |
CAS ΟΧΙ | 87-05-8 |
EINECS | 201-721-5 |
Μοριακή δομή | |
Πυκνότητα | 1.163g/cm3 |
Σημείο τήξης | 113-114℃ |
Σημείο βρασμού | 351.4°C at 760 mmHg |
Δείκτης διάθλασης | 1.548 |
Σημείο ανάφλεξης | 146.2°C |
Πίεση ατμών | 4.12E-05mmHg at 25°C |
Περιγραφή της ασφάλειας | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |