ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,6-Dihydroxyanthraquinone |
|
Ονομασία του προϊόντος | 2,6-Dihydroxyanthraquinone |
Αγγλικό όνομα | 2,6-Dihydroxyanthraquinone; |
MF | C14H8O4 |
Μοριακό βάρος | 240.2109 |
InChI | InChI=1/C14H8O4/c15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17/h1-6,15-16H |
CAS ΟΧΙ | 84-60-6 |
EINECS | 201-544-3 |
Μοριακή δομή | |
Πυκνότητα | 1.54g/cm3 |
Σημείο τήξης | 320℃ |
Σημείο βρασμού | 442.1°C at 760 mmHg |
Δείκτης διάθλασης | 1.732 |
Σημείο ανάφλεξης | 235.3°C |
Πίεση ατμών | 1.99E-08mmHg at 25°C |
Σύμβολα επικινδυνότητας | Xi##Irritant:; |
Κινδύνου Κώδικες | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Περιγραφή της ασφάλειας | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |