ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-27-2 Diethyl sec-Butylmalonate |
|
Ονομασία του προϊόντος | Diethyl sec-Butylmalonate |
Αγγλικό όνομα | Diethyl sec-Butylmalonate;Butylmalonicaciddiethylester;sec-Butylmalonic acid diethyl ester;diethyl butan-2-ylpropanedioate;diethyl [(1S)-1-methylpropyl]propanedioate;diethyl [(1R)-1-methylpropyl]propanedioate |
MF | C11H20O4 |
Μοριακό βάρος | 216.2741 |
InChI | InChI=1/C11H20O4/c1-5-8(4)9(10(12)14-6-2)11(13)15-7-3/h8-9H,5-7H2,1-4H3/t8-/m1/s1 |
CAS ΟΧΙ | 83-27-2 |
EINECS | 201-463-3 |
Μοριακή δομή | |
Πυκνότητα | 0.992g/cm3 |
Σημείο βρασμού | 247.5°C at 760 mmHg |
Δείκτης διάθλασης | 1.431 |
Σημείο ανάφλεξης | 103.1°C |
Πίεση ατμών | 0.0256mmHg at 25°C |
Περιγραφή της ασφάλειας | S24/25##Avoid contact with skin and eyes.:; |
MSDS |