ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Xanthene-9-carboxylic acid |
|
Ονομασία του προϊόντος | Xanthene-9-carboxylic acid |
Αγγλικό όνομα | Xanthene-9-carboxylic acid;xanthoic acid;Methyl xanthene-9-carboxylate;9-Xanthene carboxylic acid;Xomthene-9-carboxylic methylester acid;9H-xanthene-9-carboxylic acid;9H-xanthene-9-carboxylate |
MF | C14H9O3 |
Μοριακό βάρος | 225.22 |
InChI | InChI=1/C14H10O3/c15-14(16)13-9-5-1-3-7-11(9)17-12-8-4-2-6-10(12)13/h1-8,13H,(H,15,16)/p-1 |
CAS ΟΧΙ | 82-07-5 |
EINECS | 201-394-9 |
Μοριακή δομή | |
Σημείο τήξης | 221-225℃ |
Σημείο βρασμού | 391.3°C at 760 mmHg |
Σημείο ανάφλεξης | 153.1°C |
Πίεση ατμών | 7.99E-07mmHg at 25°C |
Κινδύνου Κώδικες | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |