ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
813-56-9 Μηλονικό-d2 οξύ-d2 |
|
Ονομασία του προϊόντος | Μηλονικό-d2 οξύ-d2 |
Συνώνυμα | Μηλονικό οξύ-d4; (~2~H_2_)προπάνιο (~2~H_2_)διοϊκό οξύ; |
Αγγλικό όνομα | Malonic-d2 acid-d2;Malonic acid-d4;(~2~H_2_)propane(~2~H_2_)dioic acid |
MF | C3D4O4 |
Μοριακό βάρος | 108.0861 |
InChI | InChI=1/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/i1D2/hD2 |
CAS ΟΧΙ | 813-56-9 |
EINECS | 212-385-4 |
Μοριακή δομή | |
Πυκνότητα | 1.605g/cm3 |
Σημείο τήξης | 130-132℃ |
Σημείο βρασμού | 386.8°C at 760 mmHg |
Δείκτης διάθλασης | 1.478 |
Σημείο ανάφλεξης | 201.9°C |
Πίεση ατμών | 4.66E-07mmHg at 25°C |
Σύμβολα επικινδυνότητας | Xn##Harmful:; |
Κινδύνου Κώδικες | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |