ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
780-05-2 N-(4-fluorophenyl)maleamic acid |
|
Ονομασία του προϊόντος | N-(4-fluorophenyl)maleamic acid |
Αγγλικό όνομα | N-(4-fluorophenyl)maleamic acid;Maleic acid mono(4-fluorophenyl)amide;(2Z)-4-[(4-fluorophenyl)amino]-4-oxobut-2-enoic acid |
MF | C10H8FNO3 |
Μοριακό βάρος | 209.1738 |
InChI | InChI=1/C10H8FNO3/c11-7-1-3-8(4-2-7)12-9(13)5-6-10(14)15/h1-6H,(H,12,13)(H,14,15)/b6-5- |
CAS ΟΧΙ | 780-05-2 |
Μοριακή δομή | |
Πυκνότητα | 1.413g/cm3 |
Σημείο τήξης | 207-209℃ |
Σημείο βρασμού | 437.3°C at 760 mmHg |
Δείκτης διάθλασης | 1.611 |
Σημείο ανάφλεξης | 218.2°C |
Πίεση ατμών | 2.03E-08mmHg at 25°C |
Κινδύνου Κώδικες | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |