ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,4-διμεθυλο-6-(1-μεθυλοκυκλοεξυλο)φαινόλη· Lowinox(rg WSL |
|
Ονομασία του προϊόντος | 2,4-διμεθυλο-6-(1-μεθυλοκυκλοεξυλο)φαινόλη· Lowinox(rg WSL |
Συνώνυμα | 6-(1-μεθυλοκυκλοεξυλο)-2,4-ξυλενόλη· |
Αγγλικό όνομα | 2,4-Dimethyl-6-(1-methylcyclohexyl)phenol;Lowinox(rg WSL;6-(1-Methylcyclohexyl)-2,4-xylenol |
MF | C15H22O |
Μοριακό βάρος | 218.3346 |
InChI | InChI=1/C15H22O/c1-11-9-12(2)14(16)13(10-11)15(3)7-5-4-6-8-15/h9-10,16H,4-8H2,1-3H3 |
CAS ΟΧΙ | 77-61-2 |
EINECS | 201-042-4 |
Μοριακή δομή | |
Πυκνότητα | 0.992g/cm3 |
Σημείο βρασμού | 311°C at 760 mmHg |
Δείκτης διάθλασης | 1.532 |
Σημείο ανάφλεξης | 140°C |
Πίεση ατμών | 0.000317mmHg at 25°C |
Κινδύνου Κώδικες | R36/37/38##Irritating to eyes, respiratory system and skin.||R43##May cause sensitization by skin contact.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |