ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
75-27-4 Bromodichloromethane |
|
Ονομασία του προϊόντος | Bromodichloromethane |
Αγγλικό όνομα | Bromodichloromethane;FC-20B1 |
MF | CHBrCl2 |
Μοριακό βάρος | 163.8286 |
InChI | InChI=1/CHBrCl2/c2-1(3)4/h1H |
CAS ΟΧΙ | 75-27-4 |
EINECS | 200-856-7 |
Μοριακή δομή | |
Πυκνότητα | 2.013g/cm3 |
Σημείο τήξης | -55℃ |
Σημείο βρασμού | 89.7°C at 760 mmHg |
Δείκτης διάθλασης | 1.503 |
Σημείο ανάφλεξης | 1.3°C |
Πίεση ατμών | 65.3mmHg at 25°C |
Σύμβολα επικινδυνότητας | Xn##Harmful:; |
Κινδύνου Κώδικες | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
Περιγραφή της ασφάλειας | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |