ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1-phenylisatin |
|
Ονομασία του προϊόντος | 1-phenylisatin |
Αγγλικό όνομα | 1-phenylisatin;1H-Indole-2,3-dione, 1-phenyl- (9CI);1-Phenyl-1H-indole-2,3-dione;1-Phenyl-indole-2,3-dione;1-Phenylisatin;5-21-10-00247 (Beilstein Handbook Reference);BRN 0164531;NSC 100013;Indole-2,3-dione, 1-phenyl- |
MF | C14H9NO2 |
Μοριακό βάρος | 223.2268 |
InChI | InChI=1/C14H9NO2/c16-13-11-8-4-5-9-12(11)15(14(13)17)10-6-2-1-3-7-10/h1-9H |
CAS ΟΧΙ | 723-89-7 |
Μοριακή δομή | |
Πυκνότητα | 1.338g/cm3 |
Σημείο τήξης | 138-140℃ |
Σημείο βρασμού | 388.8°C at 760 mmHg |
Δείκτης διάθλασης | 1.667 |
Σημείο ανάφλεξης | 182.6°C |
Πίεση ατμών | 2.99E-06mmHg at 25°C |
Περιγραφή της ασφάλειας | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |