ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
|
Ονομασία του προϊόντος | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
Αγγλικό όνομα | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene;p,p-DDE |
MF | C14H8Cl4 |
Μοριακό βάρος | 318.02 |
InChI | InChI=1/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H |
CAS ΟΧΙ | 72-55-9 |
EINECS | 200-784-6 |
Μοριακή δομή | |
Σημείο τήξης | 87-90℃ |
Υδατοδιαλυτότητα | 0.00000013 g/100 mL |
Σύμβολα επικινδυνότητας | Xn##Harmful:; |
Κινδύνου Κώδικες | R22##Harmful if swallowed.||R33##Danger of cummulative effects.:; |
Περιγραφή της ασφάλειας | S24/25##Avoid contact with skin and eyes.:; |
MSDS |