ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,2-Bis(4-chlorophenyl)-1,1-dichloroethane |
|
Ονομασία του προϊόντος | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane |
Αγγλικό όνομα | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane; |
MF | C14H10Cl4 |
Μοριακό βάρος | 320.04 |
InChI | InChI=1/C14H10Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8,13-14H |
CAS ΟΧΙ | 72-54-8 |
EINECS | 200-783-0 |
Μοριακή δομή | |
Σημείο τήξης | 109-111℃ |
Σύμβολα επικινδυνότητας | T##Toxic:; |
Κινδύνου Κώδικες | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
Περιγραφή της ασφάλειας | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |