ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Acetyl-1-naphthol |
|
Ονομασία του προϊόντος | 2-Acetyl-1-naphthol |
Αγγλικό όνομα | 2-Acetyl-1-naphthol;1-Hydroxy-2-acetonaphthone;2-Acetyl-1-hydroxynaphthalene |
MF | C12H10O2 |
Μοριακό βάρος | 186.2066 |
InChI | InChI=1/C12H10O2/c1-8(13)10-7-6-9-4-2-3-5-11(9)12(10)14/h2-7,14H,1H3 |
CAS ΟΧΙ | 711-79-5 |
EINECS | 211-918-8 |
Μοριακή δομή | |
Πυκνότητα | 1.213g/cm3 |
Σημείο τήξης | 97-100℃ |
Σημείο βρασμού | 334.9°C at 760 mmHg |
Δείκτης διάθλασης | 1.65 |
Σημείο ανάφλεξης | 142.4°C |
Πίεση ατμών | 6.37E-05mmHg at 25°C |
Σύμβολα επικινδυνότητας | Xi##Irritant:; |
Κινδύνου Κώδικες | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Περιγραφή της ασφάλειας | S24/25##Avoid contact with skin and eyes.:; |
MSDS |