ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Alpha-Ethylphenethyl alcohol |
|
Ονομασία του προϊόντος | Alpha-Ethylphenethyl alcohol |
Αγγλικό όνομα | Alpha-Ethylphenethyl alcohol;1-Phenyl-2-butanol;1-phenylbutan-2-ol;(2S)-1-phenylbutan-2-ol;(2R)-1-phenylbutan-2-ol |
MF | C10H14O |
Μοριακό βάρος | 150.2176 |
InChI | InChI=1/C10H14O/c1-2-10(11)8-9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3/t10-/m1/s1 |
CAS ΟΧΙ | 701-70-2 |
EINECS | 211-858-2 |
Μοριακή δομή | |
Πυκνότητα | 0.98g/cm3 |
Σημείο βρασμού | 226.6°C at 760 mmHg |
Δείκτης διάθλασης | 1.52 |
Σημείο ανάφλεξης | 100°C |
Πίεση ατμών | 0.0459mmHg at 25°C |
Περιγραφή της ασφάλειας | S24/25##Avoid contact with skin and eyes.:; |
MSDS |