ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
618-31-5 Alpha,Alpha-Dibromotoluene |
|
Ονομασία του προϊόντος | Alpha,Alpha-Dibromotoluene |
Αγγλικό όνομα | Alpha,Alpha-Dibromotoluene;Benzal bromide;(dibromomethyl)benzene |
MF | C7H6Br2 |
Μοριακό βάρος | 249.9305 |
InChI | InChI=1/C7H6Br2/c8-7(9)6-4-2-1-3-5-6/h1-5,7H |
CAS ΟΧΙ | 618-31-5 |
EINECS | 210-543-7 |
Μοριακή δομή | |
Πυκνότητα | 1.881g/cm3 |
Σημείο βρασμού | 276.6°C at 760 mmHg |
Δείκτης διάθλασης | 1.619 |
Σημείο ανάφλεξης | 100.2°C |
Πίεση ατμών | 0.00802mmHg at 25°C |
Σύμβολα επικινδυνότητας | T##Toxic:; |
Κινδύνου Κώδικες | R23/24##Toxic by inhalation and in contact with skin.||R33##Danger of cummulative effects.:; |
Περιγραφή της ασφάλειας | S24/25##Avoid contact with skin and eyes.:; |
MSDS |