ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,2-Dichlorobutane |
|
Ονομασία του προϊόντος | 1,2-Dichlorobutane |
Αγγλικό όνομα | 1,2-Dichlorobutane;Butane, 1,2-dichloro-;HSDB 5717;NSC 93880 |
MF | C4H8Cl2 |
Μοριακό βάρος | 127.0123 |
InChI | InChI=1/C4H8Cl2/c1-2-4(6)3-5/h4H,2-3H2,1H3 |
CAS ΟΧΙ | 616-21-7 |
EINECS | 210-469-5 |
Μοριακή δομή | |
Πυκνότητα | 1.079g/cm3 |
Σημείο βρασμού | 122.8°C at 760 mmHg |
Δείκτης διάθλασης | 1.427 |
Σημείο ανάφλεξης | 27.4°C |
Πίεση ατμών | 16.5mmHg at 25°C |
Κινδύνου Κώδικες | R10##Flammable.:; |
Περιγραφή της ασφάλειας | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |