ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
9,10-Dihydroanthracene |
|
Ονομασία του προϊόντος | 9,10-Dihydroanthracene |
Αγγλικό όνομα | 9,10-Dihydroanthracene;AI3-09026;Anthracene, dihydro-;NSC 30805;Anthracene, 9,10-dihydro- |
MF | C14H12 |
Μοριακό βάρος | 180.2451 |
InChI | InChI=1/C14H12/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-8H,9-10H2 |
CAS ΟΧΙ | 613-31-0 |
EINECS | 210-336-1 |
Μοριακή δομή | |
Πυκνότητα | 1.085g/cm3 |
Σημείο τήξης | 104-107℃ |
Σημείο βρασμού | 305°C at 760 mmHg |
Δείκτης διάθλασης | 1.62 |
Σημείο ανάφλεξης | 131.8°C |
Πίεση ατμών | 0.00152mmHg at 25°C |
Περιγραφή της ασφάλειας | S24/25##Avoid contact with skin and eyes.:; |
MSDS |