ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Aminoanthracene |
|
Ονομασία του προϊόντος | 2-Aminoanthracene |
Αγγλικό όνομα | 2-Aminoanthracene;2-anthramine practical grade*crystalline;2-anthrylamine;2-Anthramine;2-Anthranamine;anthracen-2-amine;2-Anthracenamide; |
MF | C14H11N |
Μοριακό βάρος | 193.2438 |
InChI | InChI=1/C14H11N/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H,15H2 |
CAS ΟΧΙ | 613-13-8 |
EINECS | 210-330-9 |
Μοριακή δομή | |
Πυκνότητα | 1.208g/cm3 |
Σημείο τήξης | 238-241℃ |
Σημείο βρασμού | 414.2°C at 760 mmHg |
Δείκτης διάθλασης | 1.765 |
Σημείο ανάφλεξης | 229°C |
Πίεση ατμών | 4.52E-07mmHg at 25°C |
Σύμβολα επικινδυνότητας | Xn##Harmful:; |
Κινδύνου Κώδικες | R33##Danger of cummulative effects.:; |
Περιγραφή της ασφάλειας | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |