ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Methylanthracene |
|
Ονομασία του προϊόντος | 2-Methylanthracene |
Αγγλικό όνομα | 2-Methylanthracene;CCRIS 2739;NSC 87376;Anthracene, 2-methyl- |
MF | C15H12 |
Μοριακό βάρος | 192.2558 |
InChI | InChI=1/C15H12/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13/h2-10H,1H3 |
CAS ΟΧΙ | 613-12-7 |
EINECS | 210-329-3 |
Μοριακή δομή | |
Πυκνότητα | 1.105g/cm3 |
Σημείο τήξης | 202-206℃ |
Σημείο βρασμού | 347.2°C at 760 mmHg |
Δείκτης διάθλασης | 1.693 |
Σημείο ανάφλεξης | 157.5°C |
Πίεση ατμών | 0.00011mmHg at 25°C |
Σύμβολα επικινδυνότητας | Xn##Harmful:; |
Κινδύνου Κώδικες | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Περιγραφή της ασφάλειας | S24/25##Avoid contact with skin and eyes.:; |
MSDS |