ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
612-23-7 2-Nitrobenzyl chloride |
|
Ονομασία του προϊόντος | 2-Nitrobenzyl chloride |
Αγγλικό όνομα | 2-Nitrobenzyl chloride;alpha-Chloro-2-nitrotoluene;a-Chloro-2-nitrotoluene);1-chloro-2-methyl-3-nitrobenzene;1-(chloromethyl)-2-nitrobenzene |
MF | C7H6ClNO2 |
Μοριακό βάρος | 171.581 |
InChI | InChI=1/C7H6ClNO2/c8-5-6-3-1-2-4-7(6)9(10)11/h1-4H,5H2 |
CAS ΟΧΙ | 612-23-7 |
EINECS | 210-300-5 |
Μοριακή δομή | |
Πυκνότητα | 1.33g/cm3 |
Σημείο τήξης | 46-50℃ |
Σημείο βρασμού | 269°C at 760 mmHg |
Δείκτης διάθλασης | 1.574 |
Σημείο ανάφλεξης | 112.7°C |
Πίεση ατμών | 0.0123mmHg at 25°C |
Σύμβολα επικινδυνότητας | C##Corrosive:; |
Κινδύνου Κώδικες | R34##Causes burns.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |