ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
610-57-1 2,4-Dinitrobenzyl chloride |
|
Ονομασία του προϊόντος | 2,4-Dinitrobenzyl chloride |
Αγγλικό όνομα | 2,4-Dinitrobenzyl chloride;alpha-Chloro-2,4-dinitrotoluene;4-(Chloromethyl)-1,3-dinitrobenzene;1-(chloromethyl)-2,4-dinitrobenzene |
MF | C7H5ClN2O4 |
Μοριακό βάρος | 216.5786 |
InChI | InChI=1/C7H5ClN2O4/c8-4-5-1-2-6(9(11)12)3-7(5)10(13)14/h1-3H,4H2 |
CAS ΟΧΙ | 610-57-1 |
EINECS | 210-230-5 |
Μοριακή δομή | |
Πυκνότητα | 1.538g/cm3 |
Σημείο τήξης | 34-36℃ |
Σημείο βρασμού | 349.8°C at 760 mmHg |
Δείκτης διάθλασης | 1.614 |
Σημείο ανάφλεξης | 165.4°C |
Πίεση ατμών | 9.24E-05mmHg at 25°C |
Κινδύνου Κώδικες | R34##Causes burns.||R36/37##Irritating to eyes and respiratory system.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |