ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
5-methylisatin |
|
Ονομασία του προϊόντος | 5-methylisatin |
Αγγλικό όνομα | 5-methylisatin;5-methylindole-2,3(1H)-dione;5-methyl-1H-indole-2,3-dione |
MF | C9H7NO2 |
Μοριακό βάρος | 161.1574 |
InChI | InChI=1/C9H7NO2/c1-5-2-3-7-6(4-5)8(11)9(12)10-7/h2-4H,1H3,(H,10,11,12) |
CAS ΟΧΙ | 608-05-9 |
EINECS | 210-152-1 |
Μοριακή δομή | |
Πυκνότητα | 1.301g/cm3 |
Σημείο τήξης | 180℃ (dec.) |
Δείκτης διάθλασης | 1.598 |
Περιγραφή της ασφάλειας | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |