ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
605-62-9 4-Nitro-1-Naphthol |
|
Ονομασία του προϊόντος | 4-Nitro-1-Naphthol |
Αγγλικό όνομα | 4-Nitro-1-Naphthol;4-nitronaphthalen-1-ol |
MF | C10H7NO3 |
Μοριακό βάρος | 189.1675 |
InChI | InChI=1/C10H7NO3/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6,12H |
CAS ΟΧΙ | 605-62-9 |
Μοριακή δομή | |
Πυκνότητα | 1.413g/cm3 |
Σημείο βρασμού | 398.8°C at 760 mmHg |
Δείκτης διάθλασης | 1.714 |
Σημείο ανάφλεξης | 179.8°C |
Πίεση ατμών | 6.25E-07mmHg at 25°C |
Κινδύνου Κώδικες | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Περιγραφή της ασφάλειας | S28##After contact with skin, wash immediately with plenty of ...||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |