ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
ethyl diphenylcarbamate |
|
Ονομασία του προϊόντος | ethyl diphenylcarbamate |
Αγγλικό όνομα | ethyl diphenylcarbamate; |
MF | C15H15NO2 |
Μοριακό βάρος | 241.2851 |
InChI | InChI=1/C15H15NO2/c1-2-18-15(17)16(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3 |
CAS ΟΧΙ | 603-52-1 |
EINECS | 210-047-0 |
Μοριακή δομή | |
Πυκνότητα | 1.146g/cm3 |
Σημείο τήξης | 70-72℃ |
Σημείο βρασμού | 360°C at 760 mmHg |
Δείκτης διάθλασης | 1.593 |
Σημείο ανάφλεξης | 171.5°C |
Πίεση ατμών | 2.29E-05mmHg at 25°C |
Περιγραφή της ασφάλειας | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |