ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
602-87-9 5-Nitroacenaphthene |
|
Ονομασία του προϊόντος | 5-Nitroacenaphthene |
Αγγλικό όνομα | 5-Nitroacenaphthene;1,2-Dihydro-5-nitro-acenaphthylene;4-05-00-01840 (Beilstein Handbook Reference);5-Nan;5-Nitroacenaphthylene;5-Nitroacenapthene;5-Nitronaphthalene;5-Nitronaphthalene ethylene;Acenaphthene, 5-nitro-;Acenaphthylene, 1,2-dihydro-5-nitro-;BRN 1876864;CCRIS 438;HSDB 4092;NCI-C01967;NSC 1312;NSC 22421;1,2-Dihydro-5-nitroacenaphthylene;5-nitro-1,2-dihydroacenaphthylene;Nitroacenaphthene;1,2-dihydro-5-nitro-acenaphthylen |
MF | C12H7NO2 |
Μοριακό βάρος | 197.1895 |
InChI | InChI=1/C12H7NO2/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-7H |
CAS ΟΧΙ | 602-87-9 |
EINECS | 210-025-0 |
Μοριακή δομή | ![]() |
Πυκνότητα | 1.408g/cm3 |
Σημείο τήξης | 101-102℃ |
Σημείο βρασμού | 381.6°C at 760 mmHg |
Δείκτης διάθλασης | 1.763 |
Σημείο ανάφλεξης | 196.7°C |
Πίεση ατμών | 1.1E-05mmHg at 25°C |
Κινδύνου Κώδικες | R45##May cause cancer.:; |
Περιγραφή της ασφάλειας | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.:; |
MSDS |