ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
9-Phenylanthracene |
|
Ονομασία του προϊόντος | 9-Phenylanthracene |
Αγγλικό όνομα | 9-Phenylanthracene;Phenylanthracene;anthracene,9-phenyl-;9-phenylantracene |
MF | C20H14 |
Μοριακό βάρος | 254.3252 |
InChI | InChI=1/C20H14/c1-2-8-15(9-3-1)20-18-12-6-4-10-16(18)14-17-11-5-7-13-19(17)20/h1-14H |
CAS ΟΧΙ | 602-55-1 |
EINECS | 210-019-8 |
Μοριακή δομή | |
Πυκνότητα | 1.14g/cm3 |
Σημείο τήξης | 149-153℃ |
Σημείο βρασμού | 417°C at 760 mmHg |
Δείκτης διάθλασης | 1.703 |
Σημείο ανάφλεξης | 192.1°C |
Πίεση ατμών | 8.86E-07mmHg at 25°C |
Περιγραφή της ασφάλειας | S24/25##Avoid contact with skin and eyes.:; |
MSDS |