ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
601-79-6 Isopropylmalonic acid |
|
Ονομασία του προϊόντος | Isopropylmalonic acid |
Αγγλικό όνομα | Isopropylmalonic acid;isopropyl malonic acid;propan-2-ylpropanedioic acid;(1-methylethyl)propanedioate |
MF | C6H8O4 |
Μοριακό βάρος | 144.1264 |
InChI | InChI=1/C6H10O4/c1-3(2)4(5(7)8)6(9)10/h3-4H,1-2H3,(H,7,8)(H,9,10)/p-2 |
CAS ΟΧΙ | 601-79-6 |
EINECS | 210-008-8 |
Μοριακή δομή | |
Σημείο βρασμού | 315.4°C at 760 mmHg |
Σημείο ανάφλεξης | 158.7°C |
Πίεση ατμών | 9.44E-05mmHg at 25°C |
Κινδύνου Κώδικες | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |