ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
57878-93-0 2-chloro-4-methylphenyl isothiocyanate |
|
Ονομασία του προϊόντος | 2-chloro-4-methylphenyl isothiocyanate |
Αγγλικό όνομα | 2-chloro-4-methylphenyl isothiocyanate;2-Chloro-4-methylphenyl isothiocyanate;2-chloro-1-isothiocyanato-4-methylbenzene |
MF | C8H6ClNS |
Μοριακό βάρος | 183.6579 |
InChI | InChI=1/C8H6ClNS/c1-6-2-3-8(10-5-11)7(9)4-6/h2-4H,1H3 |
CAS ΟΧΙ | 57878-93-0 |
Μοριακή δομή | |
Πυκνότητα | 1.18g/cm3 |
Σημείο βρασμού | 286.8°C at 760 mmHg |
Δείκτης διάθλασης | 1.583 |
Σημείο ανάφλεξης | 127.3°C |
Πίεση ατμών | 0.00444mmHg at 25°C |
Σύμβολα επικινδυνότητας | Xn##Harmful:; |
Κινδύνου Κώδικες | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |