ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
tetraiodoethylene |
|
Ονομασία του προϊόντος | tetraiodoethylene |
Αγγλικό όνομα | tetraiodoethylene;diiodoform;tetraiodoethene |
MF | C2I4 |
Μοριακό βάρος | 531.6393 |
InChI | InChI=1/C2I4/c3-1(4)2(5)6 |
CAS ΟΧΙ | 513-92-8 |
EINECS | 208-176-2 |
Μοριακή δομή | |
Πυκνότητα | 4.087g/cm3 |
Σημείο τήξης | 191-193℃ |
Σημείο βρασμού | 288.3°C at 760 mmHg |
Δείκτης διάθλασης | 1.952 |
Σημείο ανάφλεξης | 139.9°C |
Πίεση ατμών | 0.00409mmHg at 25°C |
Κινδύνου Κώδικες | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |