ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
stearolic acid |
|
Ονομασία του προϊόντος | stearolic acid |
Αγγλικό όνομα | stearolic acid;Octadec-9-ynoic acid |
MF | C18H32O2 |
Μοριακό βάρος | 280.4455 |
InChI | InChI=1/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-8,11-17H2,1H3,(H,19,20) |
CAS ΟΧΙ | 506-24-1 |
EINECS | 208-030-8 |
Μοριακή δομή | |
Πυκνότητα | 0.923g/cm3 |
Σημείο βρασμού | 405.2°C at 760 mmHg |
Δείκτης διάθλασης | 1.471 |
Σημείο ανάφλεξης | 196.3°C |
Πίεση ατμών | 1.07E-07mmHg at 25°C |
Περιγραφή της ασφάλειας | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |