ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
alpha,alpha-Difluoroanisole |
|
Ονομασία του προϊόντος | alpha,alpha-Difluoroanisole |
Αγγλικό όνομα | alpha,alpha-Difluoroanisole;(Difluoromethoxy)benzene |
MF | C7H6F2O |
Μοριακό βάρος | 144.1187 |
InChI | InChI=1/C7H6F2O/c8-7(9)10-6-4-2-1-3-5-6/h1-5,7H |
CAS ΟΧΙ | 458-92-4 |
EINECS | 207-283-1 |
Μοριακή δομή | |
Πυκνότητα | 1.155g/cm3 |
Σημείο βρασμού | 138°C at 760 mmHg |
Δείκτης διάθλασης | 1.445 |
Σημείο ανάφλεξης | 43.1°C |
Πίεση ατμών | 8.52mmHg at 25°C |
Κινδύνου Κώδικες | R10##Flammable.:; |
Περιγραφή της ασφάλειας | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |