ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-Fluoro-3-methylbenzoyl chloride |
|
Ονομασία του προϊόντος | 4-Fluoro-3-methylbenzoyl chloride |
Αγγλικό όνομα | 4-Fluoro-3-methylbenzoyl chloride;4-Fluoro-m-toluoyl chloride |
MF | C8H6ClFO |
Μοριακό βάρος | 172.584 |
InChI | InChI=1/C8H6ClFO/c1-5-4-6(8(9)11)2-3-7(5)10/h2-4H,1H3 |
CAS ΟΧΙ | 455-84-5 |
Μοριακή δομή | |
Πυκνότητα | 1.265g/cm3 |
Σημείο βρασμού | 214.1°C at 760 mmHg |
Δείκτης διάθλασης | 1.518 |
Σημείο ανάφλεξης | 83.3°C |
Πίεση ατμών | 0.158mmHg at 25°C |
Κινδύνου Κώδικες | R34##Causes burns.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |