ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
DL-Homocysteine |
|
Ονομασία του προϊόντος | DL-Homocysteine |
Αγγλικό όνομα | DL-Homocysteine;DL-Homocysteine 2-Amino-4-mercaptobuyric acid;homocysteine;D-homocysteine |
MF | C4H9NO2S |
Μοριακό βάρος | 135.1848 |
InChI | InChI=1/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/t3-/m1/s1 |
CAS ΟΧΙ | 454-29-5 |
EINECS | 207-222-9 |
Μοριακή δομή | |
Πυκνότητα | 1.259g/cm3 |
Σημείο τήξης | 232-233℃ |
Σημείο βρασμού | 299.7°C at 760 mmHg |
Δείκτης διάθλασης | 1.537 |
Σημείο ανάφλεξης | 135°C |
Πίεση ατμών | 0.000278mmHg at 25°C |
Περιγραφή της ασφάλειας | S24/25##Avoid contact with skin and eyes.:; |
MSDS |