ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
453-11-2 1-Chloro-3-fluoro-2-propanol |
|
Ονομασία του προϊόντος | 1-Chloro-3-fluoro-2-propanol |
Αγγλικό όνομα | 1-Chloro-3-fluoro-2-propanol;1-Chloro-3-fluoroisopropanol;1-chloro-3-fluoropropan-2-ol |
MF | C3H6ClFO |
Μοριακό βάρος | 112.5305 |
InChI | InChI=1/C3H6ClFO/c4-1-3(6)2-5/h3,6H,1-2H2 |
CAS ΟΧΙ | 453-11-2 |
Μοριακή δομή | |
Πυκνότητα | 1.212g/cm3 |
Σημείο βρασμού | 158.1°C at 760 mmHg |
Δείκτης διάθλασης | 1.399 |
Σημείο ανάφλεξης | 49.4°C |
Πίεση ατμών | 0.951mmHg at 25°C |
Κινδύνου Κώδικες | R10##Flammable.||R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Περιγραφή της ασφάλειας | S23##Do not inhale gas/fumes/vapour/spray.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |