ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2'-fluoropropiophenone |
|
Ονομασία του προϊόντος | 2'-fluoropropiophenone |
Αγγλικό όνομα | 2'-fluoropropiophenone;2'-fluoro-1-phenylpropan-1-one;1-(2'-fluorophenyl)propan-1-one;2-Fluoropropiophenone |
MF | C9H9FO |
Μοριακό βάρος | 152.1656 |
InChI | InChI=1/C9H9FO/c1-2-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
CAS ΟΧΙ | 446-22-0 |
EINECS | 244-220-7 |
Μοριακή δομή | |
Πυκνότητα | 1.074g/cm3 |
Σημείο βρασμού | 204.119°C at 760 mmHg |
Δείκτης διάθλασης | 1.489 |
Σημείο ανάφλεξης | 77.067°C |
Πίεση ατμών | 0.268mmHg at 25°C |
Κινδύνου Κώδικες | R36/38##Irritating to eyes and skin.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |