ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Bromo-5-fluoronitrobenzene |
|
Ονομασία του προϊόντος | 2-Bromo-5-fluoronitrobenzene |
Αγγλικό όνομα | 2-Bromo-5-fluoronitrobenzene;1-Bromo-4-fluoro-2-nitrobenzene |
MF | C6H3BrFNO2 |
Μοριακό βάρος | 219.9959 |
InChI | InChI=1/C6H3BrFNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
CAS ΟΧΙ | 446-09-3 |
EINECS | 207-160-2 |
Μοριακή δομή | |
Πυκνότητα | 1.808g/cm3 |
Σημείο τήξης | 37-39℃ |
Σημείο βρασμού | 220.9°C at 760 mmHg |
Δείκτης διάθλασης | 1.579 |
Σημείο ανάφλεξης | 87.4°C |
Πίεση ατμών | 0.164mmHg at 25°C |
Κινδύνου Κώδικες | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |