ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
441-38-3 alpha-Benzoin oxime |
|
Ονομασία του προϊόντος | alpha-Benzoin oxime |
Αγγλικό όνομα | alpha-Benzoin oxime;2-Hydroxy-1,2-diphenylethanone oxime (alpha-form);a-Benzoin oxime, (Cupron);(1E)-2-hydroxy-1,2-diphenylethanone oxime;(1Z)-2-hydroxy-1,2-diphenylethanone oxime;(1Z,2S)-2-hydroxy-1,2-diphenylethanone oxime;(1E,2S)-2-hydroxy-1,2-diphenylethanone oxime;(1Z,2R)-2-hydroxy-1,2-diphenylethanone oxime;α-Benzoin oxime;Benzoin α-oxime |
MF | C14H13NO2 |
Μοριακό βάρος | 227.2585 |
InChI | InChI=1/C14H13NO2/c16-14(12-9-5-2-6-10-12)13(15-17)11-7-3-1-4-8-11/h1-10,14,16-17H/b15-13-/t14-/m1/s1 |
CAS ΟΧΙ | 441-38-3 |
EINECS | 207-127-2 |
Μοριακή δομή | ![]() |
Πυκνότητα | 1.13g/cm3 |
Σημείο τήξης | 150-155℃ |
Σημείο βρασμού | 417.8°C at 760 mmHg |
Δείκτης διάθλασης | 1.58 |
Σημείο ανάφλεξης | 270.4°C |
Πίεση ατμών | 9.98E-08mmHg at 25°C |
Περιγραφή της ασφάλειας | S24/25##Avoid contact with skin and eyes.:; |
MSDS |