ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3-fluorobenzal chloride |
|
Ονομασία του προϊόντος | 3-fluorobenzal chloride |
Αγγλικό όνομα | 3-fluorobenzal chloride;alpha,alpha-Dichloro-3-fluorotoluene |
MF | C7H5Cl2F |
Μοριακό βάρος | 179.02 |
InChI | InChI=1/C7H5Cl2F/c8-7(9)5-2-1-3-6(10)4-5/h1-4,7H |
CAS ΟΧΙ | 402-64-2 |
EINECS | 206-952-5 |
Μοριακή δομή | |
Σημείο βρασμού | 195℃ |
Κινδύνου Κώδικες | R34##Causes burns.||R36##Irritating to eyes.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |