Chemindex > 370-81-0
GR ▼
370-81-0 Oxalic acid bis(cyclohexylidenehydrazide) |
|
| Ονομασία του προϊόντος | Oxalic acid bis(cyclohexylidenehydrazide) |
| Αγγλικό όνομα | Oxalic acid bis(cyclohexylidenehydrazide);Cuprizon 1;Bis(cyclohexanone)oxaldihydrazone;oxalic bis(cyclohexylidenehydrazide);N,N-oxalylbis(cyclohexanone hydrazone);Cuprizon l;cuprizon;Oxalic acid bis (cyclohexylidenehydrazide);N'~1~,N'~2~-dicyclohexylideneethanedihydrazide |
| MF | C14H22N4O2 |
| Μοριακό βάρος | 278.3501 |
| InChI | InChI=1/C14H22N4O2/c19-13(17-15-11-7-3-1-4-8-11)14(20)18-16-12-9-5-2-6-10-12/h1-10H2,(H,17,19)(H,18,20) |
| CAS ΟΧΙ | 370-81-0 |
| EINECS | 206-729-2 |
| Μοριακή δομή |  |
| Πυκνότητα | 1.29g/cm3 |
| Σημείο τήξης | 208-214℃ |
| Δείκτης διάθλασης | 1.625 |
| Σύμβολα επικινδυνότητας |  Xn##Harmful:; |
| Κινδύνου Κώδικες | R21/22##Harmful in contact with skin and if swallowed.:; |
| Περιγραφή της ασφάλειας | S2##Keep out of reach of children||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- Αν σκοπεύετε να προμηθευτείτε χημικές ουσίες από την Κίνα, απλά πηγαίνετε στο εμπορικό κέντρο ChemNet, θα πάρουμε την τελευταία και ανταγωνιστική τιμή από τους κατασκευαστές της Κίνας για εσάς.Παρακαλώ επισκεφθείτε
ChemNet Mall
Η υπηρεσία βάσεων δεδομένων Chemical CAS παρέχεται από ChemIndex.com 