ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1-(2-chloroethyl)-4-fluorobenzene |
|
Ονομασία του προϊόντος | 1-(2-chloroethyl)-4-fluorobenzene |
Αγγλικό όνομα | 1-(2-chloroethyl)-4-fluorobenzene;4-Fluorophenethyl chloride~2-(4-Fluorophenyl)ethyl chloride |
MF | C8H8ClF |
Μοριακό βάρος | 158.6005 |
InChI | InChI=1/C8H8ClF/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6H2 |
CAS ΟΧΙ | 332-43-4 |
EINECS | 206-364-9 |
Μοριακή δομή | |
Πυκνότητα | 1.15g/cm3 |
Σημείο βρασμού | 204.6°C at 760 mmHg |
Δείκτης διάθλασης | 1.501 |
Σημείο ανάφλεξης | 79.9°C |
Πίεση ατμών | 0.373mmHg at 25°C |
Κινδύνου Κώδικες | R36/38##Irritating to eyes and skin.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |