ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
331-62-4 3-fluoro-4-methoxybenzonitrile |
|
Ονομασία του προϊόντος | 3-fluoro-4-methoxybenzonitrile |
Αγγλικό όνομα | 3-fluoro-4-methoxybenzonitrile;Fluoromethoxybenzonitrile |
MF | C8H6FNO |
Μοριακό βάρος | 151.1377 |
InChI | InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
CAS ΟΧΙ | 331-62-4 |
Μοριακή δομή | ![]() |
Πυκνότητα | 1.18g/cm3 |
Σημείο βρασμού | 254.3°C at 760 mmHg |
Δείκτης διάθλασης | 1.505 |
Σημείο ανάφλεξης | 107.6°C |
Πίεση ατμών | 0.0173mmHg at 25°C |
Κινδύνου Κώδικες | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Περιγραφή της ασφάλειας | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |