ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-fluorobenzal chloride |
|
Ονομασία του προϊόντος | 2-fluorobenzal chloride |
Αγγλικό όνομα | 2-fluorobenzal chloride;alpha,alpha-Dichloro-2-fluorotoluene |
MF | C7H5Cl2F |
Μοριακό βάρος | 179.02 |
InChI | InChI=1/C7H5Cl2F/c8-7(9)5-3-1-2-4-6(5)10/h1-4,7H |
CAS ΟΧΙ | 320-65-0 |
EINECS | 206-279-7 |
Μοριακή δομή | |
Πυκνότητα | 1.3 |
Σημείο βρασμού | 224℃ |
Κινδύνου Κώδικες | R34##Causes burns.||R36##Irritating to eyes.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |