ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
DL-3-Hydroxy-n-butyric Acid |
|
Ονομασία του προϊόντος | DL-3-Hydroxy-n-butyric Acid |
Αγγλικό όνομα | DL-3-Hydroxy-n-butyric Acid;3-Hydroxybutyric acid;dl-B-hydroxybutyric acid;(3R)-3-hydroxybutanoate;DL-3-Hydroxybutanoic acid |
MF | C4H8O3 |
Μοριακό βάρος | 104.1 |
InChI | InChI=1/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7)/p-1/t3-/m1/s1 |
CAS ΟΧΙ | 300-85-6;625-71-8 |
Μοριακή δομή | |
Πυκνότητα | 1.126 |
Σημείο βρασμού | 118-120℃ (2 mmHg) |
Δείκτης διάθλασης | 1.443 |
Σημείο ανάφλεξης | >110℃ |
Πίεση ατμών | 0.000979mmHg at 25°C |
Σύμβολα επικινδυνότητας | Xi##Irritant:; |
Κινδύνου Κώδικες | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |