ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Phenanthridine |
|
Ονομασία του προϊόντος | Phenanthridine |
Αγγλικό όνομα | Phenanthridine;Phenanthridine;3,4-Benzoquinoline;Phenanthridine, (Benzo[c]quinoline) |
MF | C13H9N |
Μοριακό βάρος | 179.2173 |
InChI | InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
CAS ΟΧΙ | 229-87-8 |
EINECS | 205-934-4 |
Μοριακή δομή | |
Πυκνότητα | 1.187g/cm3 |
Σημείο τήξης | 104-107℃ |
Σημείο βρασμού | 340.8°C at 760 mmHg |
Δείκτης διάθλασης | 1.726 |
Σημείο ανάφλεξης | 155.9°C |
Πίεση ατμών | 0.000166mmHg at 25°C |
Σύμβολα επικινδυνότητας | Xn##Harmful:; |
Κινδύνου Κώδικες | R40##Possible risks of irreversible effects.:; |
Περιγραφή της ασφάλειας | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |