ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,2,3,4-Dibenzanthracene |
|
Ονομασία του προϊόντος | 1,2,3,4-Dibenzanthracene |
Αγγλικό όνομα | 1,2,3,4-Dibenzanthracene;Dibenz[a,c]anthracene;dibenz(a,c)anthracene;1,2:3,4-dibenzanthracene;Benztriphenylene;2,3-Benztriphenylene;benzo[f]tetraphene |
MF | C22H14 |
Μοριακό βάρος | 278.3466 |
InChI | InChI=1/C22H14/c1-2-8-16-14-22-20-12-6-4-10-18(20)17-9-3-5-11-19(17)21(22)13-15(16)7-1/h1-14H |
CAS ΟΧΙ | 215-58-7 |
EINECS | 205-920-8 |
Μοριακή δομή | |
Πυκνότητα | 1.232g/cm3 |
Σημείο τήξης | 202-207℃ |
Σημείο βρασμού | 518°C at 760 mmHg |
Δείκτης διάθλασης | 1.811 |
Σημείο ανάφλεξης | 264.5°C |
Πίεση ατμών | 2.55E-10mmHg at 25°C |
Σύμβολα επικινδυνότητας | Xn##Harmful:; |
Κινδύνου Κώδικες | R40##Possible risks of irreversible effects.:; |
Περιγραφή της ασφάλειας | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |