ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
13679-72-6 2-acetyl-3-methylthiophene |
|
Ονομασία του προϊόντος | 2-acetyl-3-methylthiophene |
Αγγλικό όνομα | 2-acetyl-3-methylthiophene;1-(3-methylthiophen-2-yl)ethanone;2-acetyl-3-methyl thiophene |
MF | C7H8OS |
Μοριακό βάρος | 140.2028 |
InChI | InChI=1/C7H8OS/c1-5-3-4-9-7(5)6(2)8/h3-4H,1-2H3 |
CAS ΟΧΙ | 13679-72-6 |
EINECS | 237-179-1 |
Μοριακή δομή | |
Πυκνότητα | 1.106g/cm3 |
Σημείο βρασμού | 214.9°C at 760 mmHg |
Δείκτης διάθλασης | 1.535 |
Σημείο ανάφλεξης | 92.3°C |
Πίεση ατμών | 0.152mmHg at 25°C |
Κινδύνου Κώδικες | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Περιγραφή της ασφάλειας | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |