ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Elaidic acid |
|
Ονομασία του προϊόντος | Elaidic acid |
Αγγλικό όνομα | Elaidic acid;trans-9-Octadecenoic acid~trans-Oleic acid;trans-9-Octadecenic acid;(9E)-octadec-9-enoic acid |
MF | C18H34O2 |
Μοριακό βάρος | 282.4614 |
InChI | InChI=1/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9+ |
CAS ΟΧΙ | 112-79-8 |
EINECS | 204-006-6 |
Μοριακή δομή | |
Πυκνότητα | 0.899g/cm3 |
Σημείο τήξης | 43-45℃ |
Σημείο βρασμού | 360°C at 760 mmHg |
Δείκτης διάθλασης | 1.466 |
Σημείο ανάφλεξης | 270.1°C |
Πίεση ατμών | 3.7E-06mmHg at 25°C |
Περιγραφή της ασφάλειας | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |