ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,4-Cyclohexanedimethanol, mixture of cisand trans |
|
Ονομασία του προϊόντος | 1,4-Cyclohexanedimethanol, mixture of cisand trans |
Αγγλικό όνομα | 1,4-Cyclohexanedimethanol, mixture of cisand trans;1,4-Bis(hydroxymethyl)cyclohexane;cyclohex-1,4-ylenedimethanol;1,4-Cyclohexane dimethanol;cyclohexane-1,4-diyldimethanol;1,4-Cyclohexanedimethanol;CHDM |
MF | C8H16O2 |
Μοριακό βάρος | 144.2114 |
InChI | InChI=1/C8H16O2/c9-5-7-1-2-8(6-10)4-3-7/h7-10H,1-6H2 |
CAS ΟΧΙ | 105-08-8 |
EINECS | 203-268-9 |
Μοριακή δομή | |
Πυκνότητα | 1.004g/cm3 |
Σημείο τήξης | 31.5℃ |
Σημείο βρασμού | 286.2°C at 760 mmHg |
Δείκτης διάθλασης | 1.47 |
Σημείο ανάφλεξης | 161.1°C |
Υδατοδιαλυτότητα | miscible |
Πίεση ατμών | 0.000303mmHg at 25°C |
Κινδύνου Κώδικες | R36:; |
Περιγραφή της ασφάλειας | S26||S39:; |
MSDS |