ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
N-Phenylurethane |
|
Ονομασία του προϊόντος | N-Phenylurethane |
Αγγλικό όνομα | N-Phenylurethane;Ethyl carbanilate~Ethyl N-phenylcarbamate;ethyl phenylcarbamate |
MF | C9H11NO2 |
Μοριακό βάρος | 165.1891 |
InChI | InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
CAS ΟΧΙ | 101-99-5 |
EINECS | 202-995-9 |
Μοριακή δομή | |
Πυκνότητα | 1.136g/cm3 |
Σημείο βρασμού | 238°C at 760 mmHg |
Δείκτης διάθλασης | 1.558 |
Σημείο ανάφλεξης | 79.2°C |
Πίεση ατμών | 0.0434mmHg at 25°C |
Κινδύνου Κώδικες | R40##Possible risks of irreversible effects.:; |
Περιγραφή της ασφάλειας | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |