ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
N-(4-amino-5-methoxy-2-methylphenyl)benzamide |
|
Produkt-Name | N-(4-amino-5-methoxy-2-methylphenyl)benzamide |
Englischer Name | N-(4-amino-5-methoxy-2-methylphenyl)benzamide;Benzamide, N-(4-amino-5-methoxy-2-methylphenyl)-;4'-Amino-5'-methoxy-2'-methylbenzanilide;4-amino-5-methoxy-2-methyl-N-phenylbenzamide;Fast Violet Base B;FAST VIOLER B BASE |
Molekulare Formel | C15H16N2O2 |
Molecular Weight | 256.2997 |
InChl | InChI=1/C15H16N2O2/c1-10-8-13(16)14(19-2)9-12(10)15(18)17-11-6-4-3-5-7-11/h3-9H,16H2,1-2H3,(H,17,18) |
CAS Registry Number | 99-21-8 |
EINECS | 202-740-1 |
Molecular Structure | |
Dichte | 1.215g/cm3 |
Schmelzpunkt | 185℃ |
Siedepunkt | 384.7°C at 760 mmHg |
Brechungsindex | 1.646 |
Flammpunkt | 186.5°C |
Dampfdruck | 4.01E-06mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |