Chemindex > 97-96-1
DE ▼
97-96-1 2-Ethylbutanal |
|
| Produkt-Name | 2-Ethylbutanal |
| Englischer Name | 2-Ethylbutanal;Butanal, 2-ethyl-;2-Ethylbutyraldehyde;2-Ethylbutyric aldehyde;2-Ethylbutyric aledhyde;3-Formylpentane;4-01-00-03310 (Beilstein Handbook Reference);Aldehyde 2-ethylbutyrique;Aldehyde 2-ethylbutyrique [French];BRN 1209330;Butyraldehyde, 2-ethyl-;Diethyl acetaldehyde;Diethylacetaldehyde;Ethyl butyraldehyde;FEMA No. 2426;NSC 6757;alpha-Ethylbutanal;alpha-Ethylbutyraldehyde;2-Ethylbutyraldehyde [UN1178] [Flammable liquid];UN1178 |
| Molekulare Formel | C6H12O |
| Molecular Weight | 100.1589 |
| InChl | InChI=1/C6H12O/c1-3-6(4-2)5-7/h5-6H,3-4H2,1-2H3 |
| CAS Registry Number | 97-96-1 |
| EINECS | 202-623-5 |
| Molecular Structure |  |
| Dichte | 0.799g/cm3 |
| Siedepunkt | 118.1°C at 760 mmHg |
| Brechungsindex | 1.394 |
| Flammpunkt | 21.1°C |
| Dampfdruck | 16.9mmHg at 25°C |
| Gefahrensymbole |  F##Highly flammable||Xi##Irritant:; |
| Risk Codes | R11##Highly flammable.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Beschreibung | S16##Keep away from sources of ignition - No smoking.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- Wenn Sie vorhaben, Chemikalien aus China zu beziehen, gehen Sie einfach zum Einkaufszentrum ChemNet, wir erhalten für Sie den neuesten und wettbewerbsfähigen Preis von chinesischen Herstellern.Bitte besuchen Sie
ChemNet Mall
Der CAS-Datenbankdienst für Chemikalien wird von ChemIndex.com bereitgestellt 